C27H31N5O2 — CID 89320952
1-[4-[2-[7-ethoxy-4-(3-ethynylanilino)quinazolin-6-yl]propan-2-yl]piperazin-1-yl]ethanone (PubChem CID 89320952) has the molecular formula C27H31N5O2 and a molecular weight of 457.58 g/mol. Its IUPAC name is 1-[4-[2-[7-ethoxy-4-(3-ethynylanilino)quinazolin-6-yl]propan-2-yl]piperazin-1-yl]ethanone.
| Compound Name | 1-[4-[2-[7-ethoxy-4-(3-ethynylanilino)quinazolin-6-yl]propan-2-yl]piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 89320952 |
| Molecular Formula | C27H31N5O2 |
| Molecular Weight | 457.58 g/mol |
| Exact Mass | 457.25 |
| IUPAC Name | 1-[4-[2-[7-ethoxy-4-(3-ethynylanilino)quinazolin-6-yl]propan-2-yl]piperazin-1-yl]ethanone |
| SMILES | C#Cc1cccc(Nc2ncnc3cc(OCC)c(C(C)(C)N4CCN(C(C)=O)CC4)cc23)c1 |
| InChI | InChI=1S/C27H31N5O2/c1-6-20-9-8-10-21(15-20)30-26-22-16-23(25(34-7-2)17-24(22)28-18-29-26)27(4,5)32-13-11-31(12-14-32)19(3)33/h1,8-10,15-18H,7,11-14H2,2-5H3,(H,28,29,30) |
| InChIKey | NZUPAOXZPRABGG-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.58 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|