C27H30N4O — CID 58998108
7-ethoxy-N-(3-ethynylphenyl)-6-[3-methyl-3-[methyl(propyl)amino]but-1-ynyl]quinazolin-4-amine (PubChem CID 58998108) has the molecular formula C27H30N4O and a molecular weight of 426.56 g/mol. Its IUPAC name is 7-ethoxy-N-(3-ethynylphenyl)-6-[3-methyl-3-[methyl(propyl)amino]but-1-ynyl]quinazolin-4-amine.
| Compound Name | 7-ethoxy-N-(3-ethynylphenyl)-6-[3-methyl-3-[methyl(propyl)amino]but-1-ynyl]quinazolin-4-amine |
|---|---|
| PubChem CID | 58998108 |
| Molecular Formula | C27H30N4O |
| Molecular Weight | 426.56 g/mol |
| Exact Mass | 426.24 |
| IUPAC Name | 7-ethoxy-N-(3-ethynylphenyl)-6-[3-methyl-3-[methyl(propyl)amino]but-1-ynyl]quinazolin-4-amine |
| SMILES | C#Cc1cccc(Nc2ncnc3cc(OCC)c(C#CC(C)(C)N(C)CCC)cc23)c1 |
| InChI | InChI=1S/C27H30N4O/c1-7-15-31(6)27(4,5)14-13-21-17-23-24(18-25(21)32-9-3)28-19-29-26(23)30-22-12-10-11-20(8-2)16-22/h2,10-12,16-19H,7,9,15H2,1,3-6H3,(H,28,29,30) |
| InChIKey | PWVKKVQIGFKLCT-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.56 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|