C18H14N3O2- — CID 134817524
7-ethoxy-4-(3-ethynylanilino)quinazolin-6-ol (PubChem CID 134817524) has the molecular formula C18H14N3O2- and a molecular weight of 304.33 g/mol. Its IUPAC name is 7-ethoxy-4-(3-ethynylanilino)quinazolin-6-ol.
| Compound Name | 7-ethoxy-4-(3-ethynylanilino)quinazolin-6-ol |
|---|---|
| PubChem CID | 134817524 |
| Molecular Formula | C18H14N3O2- |
| Molecular Weight | 304.33 g/mol |
| Exact Mass | 304.11 |
| IUPAC Name | 7-ethoxy-4-(3-ethynylanilino)quinazolin-6-ol |
| SMILES | C#Cc1cccc(Nc2ncnc3cc(OC[CH2-])c(O)cc23)c1 |
| InChI | InChI=1S/C18H14N3O2/c1-3-12-6-5-7-13(8-12)21-18-14-9-16(22)17(23-4-2)10-15(14)19-11-20-18/h1,5-11,22H,2,4H2,(H,19,20,21)/q-1 |
| InChIKey | CQXCYNCCKDOHTN-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 67.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.33 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|