C23H23N3O4 — CID 153457534
2-[4-(3-ethynylanilino)-7-hydroxyquinazolin-6-yl]oxyethyl 2,2-dimethylpropanoate (PubChem CID 153457534) has the molecular formula C23H23N3O4 and a molecular weight of 405.45 g/mol. Its IUPAC name is 2-[4-(3-ethynylanilino)-7-hydroxyquinazolin-6-yl]oxyethyl 2,2-dimethylpropanoate.
| Compound Name | 2-[4-(3-ethynylanilino)-7-hydroxyquinazolin-6-yl]oxyethyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 153457534 |
| Molecular Formula | C23H23N3O4 |
| Molecular Weight | 405.45 g/mol |
| Exact Mass | 405.17 |
| IUPAC Name | 2-[4-(3-ethynylanilino)-7-hydroxyquinazolin-6-yl]oxyethyl 2,2-dimethylpropanoate |
| SMILES | C#Cc1cccc(Nc2ncnc3cc(O)c(OCCOC(=O)C(C)(C)C)cc23)c1 |
| InChI | InChI=1S/C23H23N3O4/c1-5-15-7-6-8-16(11-15)26-21-17-12-20(19(27)13-18(17)24-14-25-21)29-9-10-30-22(28)23(2,3)4/h1,6-8,11-14,27H,9-10H2,2-4H3,(H,24,25,26) |
| InChIKey | VRYMICAZQZYKIG-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 93.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.45 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|