C21H20ClN3O2 — CID 154677809
6-(2-chloroethoxy)-N-(3-ethynylphenyl)-7-propoxyquinazolin-4-amine (PubChem CID 154677809) has the molecular formula C21H20ClN3O2 and a molecular weight of 381.86 g/mol. Its IUPAC name is 6-(2-chloroethoxy)-N-(3-ethynylphenyl)-7-propoxyquinazolin-4-amine.
| Compound Name | 6-(2-chloroethoxy)-N-(3-ethynylphenyl)-7-propoxyquinazolin-4-amine |
|---|---|
| PubChem CID | 154677809 |
| Molecular Formula | C21H20ClN3O2 |
| Molecular Weight | 381.86 g/mol |
| Exact Mass | 381.12 |
| IUPAC Name | 6-(2-chloroethoxy)-N-(3-ethynylphenyl)-7-propoxyquinazolin-4-amine |
| SMILES | C#Cc1cccc(Nc2ncnc3cc(OCCC)c(OCCCl)cc23)c1 |
| InChI | InChI=1S/C21H20ClN3O2/c1-3-9-26-20-13-18-17(12-19(20)27-10-8-22)21(24-14-23-18)25-16-7-5-6-15(4-2)11-16/h2,5-7,11-14H,3,8-10H2,1H3,(H,23,24,25) |
| InChIKey | WQGVABKLTSNMIF-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.86 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|