C40H50ClN5O5 — CID 162217910
6,7-dibutoxy-N-(3-ethynylphenyl)quinazolin-4-amine;6,7-dibutoxy-3H-quinazolin-4-one;hydrochloride (PubChem CID 162217910) has the molecular formula C40H50ClN5O5 and a molecular weight of 716.32 g/mol. Its IUPAC name is 6,7-dibutoxy-N-(3-ethynylphenyl)quinazolin-4-amine;6,7-dibutoxy-3H-quinazolin-4-one;hydrochloride.
| Compound Name | 6,7-dibutoxy-N-(3-ethynylphenyl)quinazolin-4-amine;6,7-dibutoxy-3H-quinazolin-4-one;hydrochloride |
|---|---|
| PubChem CID | 162217910 |
| Molecular Formula | C40H50ClN5O5 |
| Molecular Weight | 716.32 g/mol |
| Exact Mass | 715.35 |
| IUPAC Name | 6,7-dibutoxy-N-(3-ethynylphenyl)quinazolin-4-amine;6,7-dibutoxy-3H-quinazolin-4-one;hydrochloride |
| SMILES | C#Cc1cccc(Nc2ncnc3cc(OCCCC)c(OCCCC)cc23)c1.CCCCOc1cc2nc[nH]c(=O)c2cc1OCCCC.Cl |
| InChI | InChI=1S/C24H27N3O2.C16H22N2O3.ClH/c1-4-7-12-28-22-15-20-21(16-23(22)29-13-8-5-2)25-17-26-24(20)27-19-11-9-10-18(6-3)14-19;1-3-5-7-20-14-9-12-13(17-11-18-16(12)19)10-15(14)21-8-6-4-2;/h3,9-11,14-17H,4-5,7-8,12-13H2,1-2H3,(H,25,26,27);9-11H,3-8H2,1-2H3,(H,17,18,19);1H |
| InChIKey | ZTSKDMREUBBUSW-UHFFFAOYSA-N |
| XLogP | 9.42 |
| TPSA | 120.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 716.32 |
| LogP ≤ 5 | 9.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|