C24H25N3O4 — CID 58172517
7-[4-(3-ethynylanilino)-6-methoxyquinazolin-7-yl]oxy-1-hydroxyheptan-2-one (PubChem CID 58172517) has the molecular formula C24H25N3O4 and a molecular weight of 419.48 g/mol. Its IUPAC name is 7-[4-(3-ethynylanilino)-6-methoxyquinazolin-7-yl]oxy-1-hydroxyheptan-2-one.
| Compound Name | 7-[4-(3-ethynylanilino)-6-methoxyquinazolin-7-yl]oxy-1-hydroxyheptan-2-one |
|---|---|
| PubChem CID | 58172517 |
| Molecular Formula | C24H25N3O4 |
| Molecular Weight | 419.48 g/mol |
| Exact Mass | 419.18 |
| IUPAC Name | 7-[4-(3-ethynylanilino)-6-methoxyquinazolin-7-yl]oxy-1-hydroxyheptan-2-one |
| SMILES | C#Cc1cccc(Nc2ncnc3cc(OCCCCCC(=O)CO)c(OC)cc23)c1 |
| InChI | InChI=1S/C24H25N3O4/c1-3-17-8-7-9-18(12-17)27-24-20-13-22(30-2)23(14-21(20)25-16-26-24)31-11-6-4-5-10-19(29)15-28/h1,7-9,12-14,16,28H,4-6,10-11,15H2,2H3,(H,25,26,27) |
| InChIKey | UTZZCABMAJUQBU-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 93.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.48 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|