C26H30N4O2 — CID 143782893
N-[[4-(3-ethynylanilino)-7-methoxyquinazolin-6-yl]methyl]octanamide (PubChem CID 143782893) has the molecular formula C26H30N4O2 and a molecular weight of 430.55 g/mol. Its IUPAC name is N-[[4-(3-ethynylanilino)-7-methoxyquinazolin-6-yl]methyl]octanamide.
| Compound Name | N-[[4-(3-ethynylanilino)-7-methoxyquinazolin-6-yl]methyl]octanamide |
|---|---|
| PubChem CID | 143782893 |
| Molecular Formula | C26H30N4O2 |
| Molecular Weight | 430.55 g/mol |
| Exact Mass | 430.24 |
| IUPAC Name | N-[[4-(3-ethynylanilino)-7-methoxyquinazolin-6-yl]methyl]octanamide |
| SMILES | C#Cc1cccc(Nc2ncnc3cc(OC)c(CNC(=O)CCCCCCC)cc23)c1 |
| InChI | InChI=1S/C26H30N4O2/c1-4-6-7-8-9-13-25(31)27-17-20-15-22-23(16-24(20)32-3)28-18-29-26(22)30-21-12-10-11-19(5-2)14-21/h2,10-12,14-16,18H,4,6-9,13,17H2,1,3H3,(H,27,31)(H,28,29,30) |
| InChIKey | BEKGTWUPIMHPDG-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.55 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|