C28H34N4O5 — CID 143645935
7-[4-(3-ethynylanilino)-7-methoxyquinazolin-6-yl]oxyheptanal;methylamino propanoate (PubChem CID 143645935) has the molecular formula C28H34N4O5 and a molecular weight of 506.60 g/mol. Its IUPAC name is 7-[4-(3-ethynylanilino)-7-methoxyquinazolin-6-yl]oxyheptanal;methylamino propanoate.
| Compound Name | 7-[4-(3-ethynylanilino)-7-methoxyquinazolin-6-yl]oxyheptanal;methylamino propanoate |
|---|---|
| PubChem CID | 143645935 |
| Molecular Formula | C28H34N4O5 |
| Molecular Weight | 506.60 g/mol |
| Exact Mass | 506.25 |
| IUPAC Name | 7-[4-(3-ethynylanilino)-7-methoxyquinazolin-6-yl]oxyheptanal;methylamino propanoate |
| SMILES | C#Cc1cccc(Nc2ncnc3cc(OC)c(OCCCCCCC=O)cc23)c1.CCC(=O)ONC |
| InChI | InChI=1S/C24H25N3O3.C4H9NO2/c1-3-18-10-9-11-19(14-18)27-24-20-15-23(30-13-8-6-4-5-7-12-28)22(29-2)16-21(20)25-17-26-24;1-3-4(6)7-5-2/h1,9-12,14-17H,4-8,13H2,2H3,(H,25,26,27);5H,3H2,1-2H3 |
| InChIKey | FFMDLVIUQMCWED-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 111.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.60 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|