C28H32N4O10 — CID 25225113
2,3-dihydroxybutanedioic acid;7-[4-(3-ethynylanilino)-7-methoxyquinazolin-6-yl]oxy-N-hydroxyheptanamide (PubChem CID 25225113) has the molecular formula C28H32N4O10 and a molecular weight of 584.58 g/mol. Its IUPAC name is 2,3-dihydroxybutanedioic acid;7-[4-(3-ethynylanilino)-7-methoxyquinazolin-6-yl]oxy-N-hydroxyheptanamide.
| Compound Name | 2,3-dihydroxybutanedioic acid;7-[4-(3-ethynylanilino)-7-methoxyquinazolin-6-yl]oxy-N-hydroxyheptanamide |
|---|---|
| PubChem CID | 25225113 |
| Molecular Formula | C28H32N4O10 |
| Molecular Weight | 584.58 g/mol |
| Exact Mass | 584.21 |
| IUPAC Name | 2,3-dihydroxybutanedioic acid;7-[4-(3-ethynylanilino)-7-methoxyquinazolin-6-yl]oxy-N-hydroxyheptanamide |
| SMILES | C#Cc1cccc(Nc2ncnc3cc(OC)c(OCCCCCCC(=O)NO)cc23)c1.O=C(O)C(O)C(O)C(=O)O |
| InChI | InChI=1S/C24H26N4O4.C4H6O6/c1-3-17-9-8-10-18(13-17)27-24-19-14-22(21(31-2)15-20(19)25-16-26-24)32-12-7-5-4-6-11-23(29)28-30;5-1(3(7)8)2(6)4(9)10/h1,8-10,13-16,30H,4-7,11-12H2,2H3,(H,28,29)(H,25,26,27);1-2,5-6H,(H,7,8)(H,9,10) |
| InChIKey | NVABJQJNTPCROO-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 220.66 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.58 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|