C27H32N4O4 — CID 58172574
5-[2-[4-(3-ethynylanilino)-7-methoxyquinazolin-6-yl]oxyethyl-propan-2-ylamino]-1-hydroxypentan-2-one (PubChem CID 58172574) has the molecular formula C27H32N4O4 and a molecular weight of 476.58 g/mol. Its IUPAC name is 5-[2-[4-(3-ethynylanilino)-7-methoxyquinazolin-6-yl]oxyethyl-propan-2-ylamino]-1-hydroxypentan-2-one.
| Compound Name | 5-[2-[4-(3-ethynylanilino)-7-methoxyquinazolin-6-yl]oxyethyl-propan-2-ylamino]-1-hydroxypentan-2-one |
|---|---|
| PubChem CID | 58172574 |
| Molecular Formula | C27H32N4O4 |
| Molecular Weight | 476.58 g/mol |
| Exact Mass | 476.24 |
| IUPAC Name | 5-[2-[4-(3-ethynylanilino)-7-methoxyquinazolin-6-yl]oxyethyl-propan-2-ylamino]-1-hydroxypentan-2-one |
| SMILES | C#Cc1cccc(Nc2ncnc3cc(OC)c(OCCN(CCCC(=O)CO)C(C)C)cc23)c1 |
| InChI | InChI=1S/C27H32N4O4/c1-5-20-8-6-9-21(14-20)30-27-23-15-26(25(34-4)16-24(23)28-18-29-27)35-13-12-31(19(2)3)11-7-10-22(33)17-32/h1,6,8-9,14-16,18-19,32H,7,10-13,17H2,2-4H3,(H,28,29,30) |
| InChIKey | ZARONWLDRMKPKC-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 96.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.58 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|