C26H29N3O4 — CID 58172554
8-[4-(3-ethynylanilino)-7-methoxyquinazolin-6-yl]oxy-1-hydroxy-3-methyloctan-2-one (PubChem CID 58172554) has the molecular formula C26H29N3O4 and a molecular weight of 447.54 g/mol. Its IUPAC name is 8-[4-(3-ethynylanilino)-7-methoxyquinazolin-6-yl]oxy-1-hydroxy-3-methyloctan-2-one.
| Compound Name | 8-[4-(3-ethynylanilino)-7-methoxyquinazolin-6-yl]oxy-1-hydroxy-3-methyloctan-2-one |
|---|---|
| PubChem CID | 58172554 |
| Molecular Formula | C26H29N3O4 |
| Molecular Weight | 447.54 g/mol |
| Exact Mass | 447.22 |
| IUPAC Name | 8-[4-(3-ethynylanilino)-7-methoxyquinazolin-6-yl]oxy-1-hydroxy-3-methyloctan-2-one |
| SMILES | C#Cc1cccc(Nc2ncnc3cc(OC)c(OCCCCCC(C)C(=O)CO)cc23)c1 |
| InChI | InChI=1S/C26H29N3O4/c1-4-19-10-8-11-20(13-19)29-26-21-14-25(24(32-3)15-22(21)27-17-28-26)33-12-7-5-6-9-18(2)23(31)16-30/h1,8,10-11,13-15,17-18,30H,5-7,9,12,16H2,2-3H3,(H,27,28,29) |
| InChIKey | CVHZYQKSIULRED-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 93.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.54 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|