C27H32N4O5 — CID 143645942
7-[4-(3-ethynylanilino)-7-methoxyquinazolin-6-yl]oxyheptanal;methylamino acetate (PubChem CID 143645942) has the molecular formula C27H32N4O5 and a molecular weight of 492.58 g/mol. Its IUPAC name is 7-[4-(3-ethynylanilino)-7-methoxyquinazolin-6-yl]oxyheptanal;methylamino acetate.
| Compound Name | 7-[4-(3-ethynylanilino)-7-methoxyquinazolin-6-yl]oxyheptanal;methylamino acetate |
|---|---|
| PubChem CID | 143645942 |
| Molecular Formula | C27H32N4O5 |
| Molecular Weight | 492.58 g/mol |
| Exact Mass | 492.24 |
| IUPAC Name | 7-[4-(3-ethynylanilino)-7-methoxyquinazolin-6-yl]oxyheptanal;methylamino acetate |
| SMILES | C#Cc1cccc(Nc2ncnc3cc(OC)c(OCCCCCCC=O)cc23)c1.CNOC(C)=O |
| InChI | InChI=1S/C24H25N3O3.C3H7NO2/c1-3-18-10-9-11-19(14-18)27-24-20-15-23(30-13-8-6-4-5-7-12-28)22(29-2)16-21(20)25-17-26-24;1-3(5)6-4-2/h1,9-12,14-17H,4-8,13H2,2H3,(H,25,26,27);4H,1-2H3 |
| InChIKey | DWZJBUGRAYWRLV-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 111.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.58 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|