C38H44BN3O6 — CID 148859120
8-[4-(3-ethynylanilino)-7-methoxyquinazolin-6-yl]oxy-1-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methoxy]octan-2-one (PubChem CID 148859120) has the molecular formula C38H44BN3O6 and a molecular weight of 649.60 g/mol. Its IUPAC name is 8-[4-(3-ethynylanilino)-7-methoxyquinazolin-6-yl]oxy-1-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methoxy]octan-2-one.
| Compound Name | 8-[4-(3-ethynylanilino)-7-methoxyquinazolin-6-yl]oxy-1-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methoxy]octan-2-one |
|---|---|
| PubChem CID | 148859120 |
| Molecular Formula | C38H44BN3O6 |
| Molecular Weight | 649.60 g/mol |
| Exact Mass | 649.33 |
| IUPAC Name | 8-[4-(3-ethynylanilino)-7-methoxyquinazolin-6-yl]oxy-1-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methoxy]octan-2-one |
| SMILES | C#Cc1cccc(Nc2ncnc3cc(OC)c(OCCCCCCC(=O)COCc4ccc(B5OC(C)(C)C(C)(C)O5)cc4)cc23)c1 |
| InChI | InChI=1S/C38H44BN3O6/c1-7-27-13-12-14-30(21-27)42-36-32-22-35(34(44-6)23-33(32)40-26-41-36)46-20-11-9-8-10-15-31(43)25-45-24-28-16-18-29(19-17-28)39-47-37(2,3)38(4,5)48-39/h1,12-14,16-19,21-23,26H,8-11,15,20,24-25H2,2-6H3,(H,40,41,42) |
| InChIKey | OYYWRGBJPZZDRE-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 101.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.60 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|