C20H21ClN4O4 — CID 122195527
5-[4-(3-chloroanilino)-7-methoxyquinazolin-6-yl]oxy-N-hydroxypentanamide (PubChem CID 122195527) has the molecular formula C20H21ClN4O4 and a molecular weight of 416.87 g/mol. Its IUPAC name is 5-[4-(3-chloroanilino)-7-methoxyquinazolin-6-yl]oxy-N-hydroxypentanamide.
| Compound Name | 5-[4-(3-chloroanilino)-7-methoxyquinazolin-6-yl]oxy-N-hydroxypentanamide |
|---|---|
| PubChem CID | 122195527 |
| Molecular Formula | C20H21ClN4O4 |
| Molecular Weight | 416.87 g/mol |
| Exact Mass | 416.13 |
| IUPAC Name | 5-[4-(3-chloroanilino)-7-methoxyquinazolin-6-yl]oxy-N-hydroxypentanamide |
| SMILES | COc1cc2ncnc(Nc3cccc(Cl)c3)c2cc1OCCCCC(=O)NO |
| InChI | InChI=1S/C20H21ClN4O4/c1-28-17-11-16-15(10-18(17)29-8-3-2-7-19(26)25-27)20(23-12-22-16)24-14-6-4-5-13(21)9-14/h4-6,9-12,27H,2-3,7-8H2,1H3,(H,25,26)(H,22,23,24) |
| InChIKey | ZTLUHMBJQIQLKN-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 105.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.87 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|