C27H29N5O5S — CID 164622206
5-[7-methoxy-4-(3-methylanilino)quinazolin-6-yl]oxy-N-(4-sulfamoylphenyl)pentanamide (PubChem CID 164622206) has the molecular formula C27H29N5O5S and a molecular weight of 535.63 g/mol. Its IUPAC name is 5-[7-methoxy-4-(3-methylanilino)quinazolin-6-yl]oxy-N-(4-sulfamoylphenyl)pentanamide.
| Compound Name | 5-[7-methoxy-4-(3-methylanilino)quinazolin-6-yl]oxy-N-(4-sulfamoylphenyl)pentanamide |
|---|---|
| PubChem CID | 164622206 |
| Molecular Formula | C27H29N5O5S |
| Molecular Weight | 535.63 g/mol |
| Exact Mass | 535.19 |
| IUPAC Name | 5-[7-methoxy-4-(3-methylanilino)quinazolin-6-yl]oxy-N-(4-sulfamoylphenyl)pentanamide |
| SMILES | COc1cc2ncnc(Nc3cccc(C)c3)c2cc1OCCCCC(=O)Nc1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C27H29N5O5S/c1-18-6-5-7-20(14-18)32-27-22-15-25(24(36-2)16-23(22)29-17-30-27)37-13-4-3-8-26(33)31-19-9-11-21(12-10-19)38(28,34)35/h5-7,9-12,14-17H,3-4,8,13H2,1-2H3,(H,31,33)(H2,28,34,35)(H,29,30,32) |
| InChIKey | VAAIPMKDWMLRPT-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 145.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.63 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|