C31H33N3O5 — CID 141401410
ethyl 7-[4-(4-benzoylanilino)-7-methoxyquinazolin-6-yl]oxyheptanoate (PubChem CID 141401410) has the molecular formula C31H33N3O5 and a molecular weight of 527.62 g/mol. Its IUPAC name is ethyl 7-[4-(4-benzoylanilino)-7-methoxyquinazolin-6-yl]oxyheptanoate.
| Compound Name | ethyl 7-[4-(4-benzoylanilino)-7-methoxyquinazolin-6-yl]oxyheptanoate |
|---|---|
| PubChem CID | 141401410 |
| Molecular Formula | C31H33N3O5 |
| Molecular Weight | 527.62 g/mol |
| Exact Mass | 527.24 |
| IUPAC Name | ethyl 7-[4-(4-benzoylanilino)-7-methoxyquinazolin-6-yl]oxyheptanoate |
| SMILES | CCOC(=O)CCCCCCOc1cc2c(Nc3ccc(C(=O)c4ccccc4)cc3)ncnc2cc1OC |
| InChI | InChI=1S/C31H33N3O5/c1-3-38-29(35)13-9-4-5-10-18-39-28-19-25-26(20-27(28)37-2)32-21-33-31(25)34-24-16-14-23(15-17-24)30(36)22-11-7-6-8-12-22/h6-8,11-12,14-17,19-21H,3-5,9-10,13,18H2,1-2H3,(H,32,33,34) |
| InChIKey | SHISKJBFEMKXRK-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 99.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.62 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|