C26H32ClN3O4 — CID 45141768
ethyl 7-[4-[[(1S)-1-(4-chlorophenyl)ethyl]amino]-7-methoxyquinazolin-6-yl]oxyheptanoate (PubChem CID 45141768) has the molecular formula C26H32ClN3O4 and a molecular weight of 486.01 g/mol. Its IUPAC name is ethyl 7-[4-[[(1S)-1-(4-chlorophenyl)ethyl]amino]-7-methoxyquinazolin-6-yl]oxyheptanoate.
| Compound Name | ethyl 7-[4-[[(1S)-1-(4-chlorophenyl)ethyl]amino]-7-methoxyquinazolin-6-yl]oxyheptanoate |
|---|---|
| PubChem CID | 45141768 |
| Molecular Formula | C26H32ClN3O4 |
| Molecular Weight | 486.01 g/mol |
| Exact Mass | 485.21 |
| IUPAC Name | ethyl 7-[4-[[(1S)-1-(4-chlorophenyl)ethyl]amino]-7-methoxyquinazolin-6-yl]oxyheptanoate |
| SMILES | CCOC(=O)CCCCCCOc1cc2c(N[C@@H](C)c3ccc(Cl)cc3)ncnc2cc1OC |
| InChI | InChI=1S/C26H32ClN3O4/c1-4-33-25(31)9-7-5-6-8-14-34-24-15-21-22(16-23(24)32-3)28-17-29-26(21)30-18(2)19-10-12-20(27)13-11-19/h10-13,15-18H,4-9,14H2,1-3H3,(H,28,29,30)/t18-/m0/s1 |
| InChIKey | WTANIPDTFXUMMV-SFHVURJKSA-N |
| XLogP | 6.36 |
| TPSA | 82.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.01 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|