C24H26ClN3O6 — CID 141424493
methyl 6-[2-[(6-acetyloxy-7-methoxyquinazolin-4-yl)amino]-4-chlorophenoxy]hexanoate (PubChem CID 141424493) has the molecular formula C24H26ClN3O6 and a molecular weight of 487.94 g/mol. Its IUPAC name is methyl 6-[2-[(6-acetyloxy-7-methoxyquinazolin-4-yl)amino]-4-chlorophenoxy]hexanoate.
| Compound Name | methyl 6-[2-[(6-acetyloxy-7-methoxyquinazolin-4-yl)amino]-4-chlorophenoxy]hexanoate |
|---|---|
| PubChem CID | 141424493 |
| Molecular Formula | C24H26ClN3O6 |
| Molecular Weight | 487.94 g/mol |
| Exact Mass | 487.15 |
| IUPAC Name | methyl 6-[2-[(6-acetyloxy-7-methoxyquinazolin-4-yl)amino]-4-chlorophenoxy]hexanoate |
| SMILES | COC(=O)CCCCCOc1ccc(Cl)cc1Nc1ncnc2cc(OC)c(OC(C)=O)cc12 |
| InChI | InChI=1S/C24H26ClN3O6/c1-15(29)34-22-12-17-18(13-21(22)31-2)26-14-27-24(17)28-19-11-16(25)8-9-20(19)33-10-6-4-5-7-23(30)32-3/h8-9,11-14H,4-7,10H2,1-3H3,(H,26,27,28) |
| InChIKey | TYCJDHQSPKJLNI-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 108.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.94 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|