C24H25ClFN3O4 — CID 42597705
7-[4-(3-chloro-4-fluoroanilino)-7-methoxyquinazolin-6-yl]oxy-1-(oxiran-2-yl)heptan-1-one (PubChem CID 42597705) has the molecular formula C24H25ClFN3O4 and a molecular weight of 473.93 g/mol. Its IUPAC name is 7-[4-(3-chloro-4-fluoroanilino)-7-methoxyquinazolin-6-yl]oxy-1-(oxiran-2-yl)heptan-1-one.
| Compound Name | 7-[4-(3-chloro-4-fluoroanilino)-7-methoxyquinazolin-6-yl]oxy-1-(oxiran-2-yl)heptan-1-one |
|---|---|
| PubChem CID | 42597705 |
| Molecular Formula | C24H25ClFN3O4 |
| Molecular Weight | 473.93 g/mol |
| Exact Mass | 473.15 |
| IUPAC Name | 7-[4-(3-chloro-4-fluoroanilino)-7-methoxyquinazolin-6-yl]oxy-1-(oxiran-2-yl)heptan-1-one |
| SMILES | COc1cc2ncnc(Nc3ccc(F)c(Cl)c3)c2cc1OCCCCCCC(=O)C1CO1 |
| InChI | InChI=1S/C24H25ClFN3O4/c1-31-21-12-19-16(24(28-14-27-19)29-15-7-8-18(26)17(25)10-15)11-22(21)32-9-5-3-2-4-6-20(30)23-13-33-23/h7-8,10-12,14,23H,2-6,9,13H2,1H3,(H,27,28,29) |
| InChIKey | VNYSZSUIHSJKGP-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 85.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.93 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|