C25H31ClFN5O5 — CID 163927751
3-[2-(2-aminoethoxy)ethoxy]-N-[3-[4-(3-chloro-4-fluoroanilino)-7-methoxyquinazolin-6-yl]oxypropyl]propanamide (PubChem CID 163927751) has the molecular formula C25H31ClFN5O5 and a molecular weight of 536.00 g/mol. Its IUPAC name is 3-[2-(2-aminoethoxy)ethoxy]-N-[3-[4-(3-chloro-4-fluoroanilino)-7-methoxyquinazolin-6-yl]oxypropyl]propanamide.
| Compound Name | 3-[2-(2-aminoethoxy)ethoxy]-N-[3-[4-(3-chloro-4-fluoroanilino)-7-methoxyquinazolin-6-yl]oxypropyl]propanamide |
|---|---|
| PubChem CID | 163927751 |
| Molecular Formula | C25H31ClFN5O5 |
| Molecular Weight | 536.00 g/mol |
| Exact Mass | 535.20 |
| IUPAC Name | 3-[2-(2-aminoethoxy)ethoxy]-N-[3-[4-(3-chloro-4-fluoroanilino)-7-methoxyquinazolin-6-yl]oxypropyl]propanamide |
| SMILES | COc1cc2ncnc(Nc3ccc(F)c(Cl)c3)c2cc1OCCCNC(=O)CCOCCOCCN |
| InChI | InChI=1S/C25H31ClFN5O5/c1-34-22-15-21-18(25(31-16-30-21)32-17-3-4-20(27)19(26)13-17)14-23(22)37-8-2-7-29-24(33)5-9-35-11-12-36-10-6-28/h3-4,13-16H,2,5-12,28H2,1H3,(H,29,33)(H,30,31,32) |
| InChIKey | RFYZCHQDMXLJFY-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 129.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.00 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|