C19H18ClFN4O4S — CID 143645931
4-[4-(3-chloro-4-fluoroanilino)-7-methoxyquinazolin-6-yl]oxysulfanyl-N-hydroxybutanamide (PubChem CID 143645931) has the molecular formula C19H18ClFN4O4S and a molecular weight of 452.90 g/mol. Its IUPAC name is 4-[4-(3-chloro-4-fluoroanilino)-7-methoxyquinazolin-6-yl]oxysulfanyl-N-hydroxybutanamide.
| Compound Name | 4-[4-(3-chloro-4-fluoroanilino)-7-methoxyquinazolin-6-yl]oxysulfanyl-N-hydroxybutanamide |
|---|---|
| PubChem CID | 143645931 |
| Molecular Formula | C19H18ClFN4O4S |
| Molecular Weight | 452.90 g/mol |
| Exact Mass | 452.07 |
| IUPAC Name | 4-[4-(3-chloro-4-fluoroanilino)-7-methoxyquinazolin-6-yl]oxysulfanyl-N-hydroxybutanamide |
| SMILES | COc1cc2ncnc(Nc3ccc(F)c(Cl)c3)c2cc1OSCCCC(=O)NO |
| InChI | InChI=1S/C19H18ClFN4O4S/c1-28-16-9-15-12(8-17(16)29-30-6-2-3-18(26)25-27)19(23-10-22-15)24-11-4-5-14(21)13(20)7-11/h4-5,7-10,27H,2-3,6H2,1H3,(H,25,26)(H,22,23,24) |
| InChIKey | DSZGJJSUJWCBSO-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 105.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.90 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|