C21H20ClFN4O10 — CID 25224747
2-[4-(3-chloro-4-fluoroanilino)-7-methoxyquinazolin-6-yl]oxy-N-hydroxyacetamide;2,3-dihydroxybutanedioic acid (PubChem CID 25224747) has the molecular formula C21H20ClFN4O10 and a molecular weight of 542.86 g/mol. Its IUPAC name is 2-[4-(3-chloro-4-fluoroanilino)-7-methoxyquinazolin-6-yl]oxy-N-hydroxyacetamide;2,3-dihydroxybutanedioic acid.
| Compound Name | 2-[4-(3-chloro-4-fluoroanilino)-7-methoxyquinazolin-6-yl]oxy-N-hydroxyacetamide;2,3-dihydroxybutanedioic acid |
|---|---|
| PubChem CID | 25224747 |
| Molecular Formula | C21H20ClFN4O10 |
| Molecular Weight | 542.86 g/mol |
| Exact Mass | 542.09 |
| IUPAC Name | 2-[4-(3-chloro-4-fluoroanilino)-7-methoxyquinazolin-6-yl]oxy-N-hydroxyacetamide;2,3-dihydroxybutanedioic acid |
| SMILES | COc1cc2ncnc(Nc3ccc(F)c(Cl)c3)c2cc1OCC(=O)NO.O=C(O)C(O)C(O)C(=O)O |
| InChI | InChI=1S/C17H14ClFN4O4.C4H6O6/c1-26-14-6-13-10(5-15(14)27-7-16(24)23-25)17(21-8-20-13)22-9-2-3-12(19)11(18)4-9;5-1(3(7)8)2(6)4(9)10/h2-6,8,25H,7H2,1H3,(H,23,24)(H,20,21,22);1-2,5-6H,(H,7,8)(H,9,10) |
| InChIKey | CFRROQLEJQOLFL-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 220.66 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.86 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|