C18H17ClFN3O3 — CID 150119813
N-(3-chloro-4-fluorophenyl)-6-(ethoxymethoxy)-7-methoxyquinazolin-4-amine (PubChem CID 150119813) has the molecular formula C18H17ClFN3O3 and a molecular weight of 377.80 g/mol. Its IUPAC name is N-(3-chloro-4-fluorophenyl)-6-(ethoxymethoxy)-7-methoxyquinazolin-4-amine.
| Compound Name | N-(3-chloro-4-fluorophenyl)-6-(ethoxymethoxy)-7-methoxyquinazolin-4-amine |
|---|---|
| PubChem CID | 150119813 |
| Molecular Formula | C18H17ClFN3O3 |
| Molecular Weight | 377.80 g/mol |
| Exact Mass | 377.09 |
| IUPAC Name | N-(3-chloro-4-fluorophenyl)-6-(ethoxymethoxy)-7-methoxyquinazolin-4-amine |
| SMILES | CCOCOc1cc2c(Nc3ccc(F)c(Cl)c3)ncnc2cc1OC |
| InChI | InChI=1S/C18H17ClFN3O3/c1-3-25-10-26-17-7-12-15(8-16(17)24-2)21-9-22-18(12)23-11-4-5-14(20)13(19)6-11/h4-9H,3,10H2,1-2H3,(H,21,22,23) |
| InChIKey | DYZXDCDLKHYQEC-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 65.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.80 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|