C27H26ClFN4O2 — CID 69204918
6-(4-anilinocyclohexyl)oxy-N-(3-chloro-4-fluorophenyl)-7-methoxyquinazolin-4-amine (PubChem CID 69204918) has the molecular formula C27H26ClFN4O2 and a molecular weight of 492.98 g/mol. Its IUPAC name is 6-(4-anilinocyclohexyl)oxy-N-(3-chloro-4-fluorophenyl)-7-methoxyquinazolin-4-amine.
| Compound Name | 6-(4-anilinocyclohexyl)oxy-N-(3-chloro-4-fluorophenyl)-7-methoxyquinazolin-4-amine |
|---|---|
| PubChem CID | 69204918 |
| Molecular Formula | C27H26ClFN4O2 |
| Molecular Weight | 492.98 g/mol |
| Exact Mass | 492.17 |
| IUPAC Name | 6-(4-anilinocyclohexyl)oxy-N-(3-chloro-4-fluorophenyl)-7-methoxyquinazolin-4-amine |
| SMILES | COc1cc2ncnc(Nc3ccc(F)c(Cl)c3)c2cc1OC1CCC(Nc2ccccc2)CC1 |
| InChI | InChI=1S/C27H26ClFN4O2/c1-34-25-15-24-21(27(31-16-30-24)33-19-9-12-23(29)22(28)13-19)14-26(25)35-20-10-7-18(8-11-20)32-17-5-3-2-4-6-17/h2-6,9,12-16,18,20,32H,7-8,10-11H2,1H3,(H,30,31,33) |
| InChIKey | CHYZQEJCEYLGIN-UHFFFAOYSA-N |
| XLogP | 6.98 |
| TPSA | 68.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.98 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |