C28H34ClFN6O3 — CID 20819651
1-[3-[[4-[4-(3-chloro-4-fluoroanilino)-7-methoxyquinazolin-6-yl]oxycyclohexyl]amino]propyl]-1,3-diazinan-2-one (PubChem CID 20819651) has the molecular formula C28H34ClFN6O3 and a molecular weight of 557.07 g/mol. Its IUPAC name is 1-[3-[[4-[4-(3-chloro-4-fluoroanilino)-7-methoxyquinazolin-6-yl]oxycyclohexyl]amino]propyl]-1,3-diazinan-2-one.
| Compound Name | 1-[3-[[4-[4-(3-chloro-4-fluoroanilino)-7-methoxyquinazolin-6-yl]oxycyclohexyl]amino]propyl]-1,3-diazinan-2-one |
|---|---|
| PubChem CID | 20819651 |
| Molecular Formula | C28H34ClFN6O3 |
| Molecular Weight | 557.07 g/mol |
| Exact Mass | 556.24 |
| IUPAC Name | 1-[3-[[4-[4-(3-chloro-4-fluoroanilino)-7-methoxyquinazolin-6-yl]oxycyclohexyl]amino]propyl]-1,3-diazinan-2-one |
| SMILES | COc1cc2ncnc(Nc3ccc(F)c(Cl)c3)c2cc1OC1CCC(NCCCN2CCCNC2=O)CC1 |
| InChI | InChI=1S/C28H34ClFN6O3/c1-38-25-16-24-21(27(34-17-33-24)35-19-6-9-23(30)22(29)14-19)15-26(25)39-20-7-4-18(5-8-20)31-10-2-12-36-13-3-11-32-28(36)37/h6,9,14-18,20,31H,2-5,7-8,10-13H2,1H3,(H,32,37)(H,33,34,35) |
| InChIKey | ONFMTVQVMMURSP-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 100.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.07 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|