C19H19ClN4O4 — CID 122195526
4-[4-(3-chloroanilino)-7-methoxyquinazolin-6-yl]oxy-N-hydroxybutanamide (PubChem CID 122195526) has the molecular formula C19H19ClN4O4 and a molecular weight of 402.84 g/mol. Its IUPAC name is 4-[4-(3-chloroanilino)-7-methoxyquinazolin-6-yl]oxy-N-hydroxybutanamide.
| Compound Name | 4-[4-(3-chloroanilino)-7-methoxyquinazolin-6-yl]oxy-N-hydroxybutanamide |
|---|---|
| PubChem CID | 122195526 |
| Molecular Formula | C19H19ClN4O4 |
| Molecular Weight | 402.84 g/mol |
| Exact Mass | 402.11 |
| IUPAC Name | 4-[4-(3-chloroanilino)-7-methoxyquinazolin-6-yl]oxy-N-hydroxybutanamide |
| SMILES | COc1cc2ncnc(Nc3cccc(Cl)c3)c2cc1OCCCC(=O)NO |
| InChI | InChI=1S/C19H19ClN4O4/c1-27-16-10-15-14(9-17(16)28-7-3-6-18(25)24-26)19(22-11-21-15)23-13-5-2-4-12(20)8-13/h2,4-5,8-11,26H,3,6-7H2,1H3,(H,24,25)(H,21,22,23) |
| InChIKey | XASPRINVUUODIB-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 105.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.84 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|