C24H21Cl2N5O3 — CID 57447230
3-chloro-N-[5-[[7-(3-chloropropoxy)-6-methoxyquinazolin-4-yl]amino]-2-pyridinyl]benzamide (PubChem CID 57447230) has the molecular formula C24H21Cl2N5O3 and a molecular weight of 498.37 g/mol. Its IUPAC name is 3-chloro-N-[5-[[7-(3-chloropropoxy)-6-methoxyquinazolin-4-yl]amino]-2-pyridinyl]benzamide.
| Compound Name | 3-chloro-N-[5-[[7-(3-chloropropoxy)-6-methoxyquinazolin-4-yl]amino]-2-pyridinyl]benzamide |
|---|---|
| PubChem CID | 57447230 |
| Molecular Formula | C24H21Cl2N5O3 |
| Molecular Weight | 498.37 g/mol |
| Exact Mass | 497.10 |
| IUPAC Name | 3-chloro-N-[5-[[7-(3-chloropropoxy)-6-methoxyquinazolin-4-yl]amino]-2-pyridinyl]benzamide |
| SMILES | COc1cc2c(Nc3ccc(NC(=O)c4cccc(Cl)c4)nc3)ncnc2cc1OCCCCl |
| InChI | InChI=1S/C24H21Cl2N5O3/c1-33-20-11-18-19(12-21(20)34-9-3-8-25)28-14-29-23(18)30-17-6-7-22(27-13-17)31-24(32)15-4-2-5-16(26)10-15/h2,4-7,10-14H,3,8-9H2,1H3,(H,27,31,32)(H,28,29,30) |
| InChIKey | JZUFITZPQMCKCR-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 98.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.37 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|