C30H30ClN7O3 — CID 69308865
3-chloro-N-[5-[[7-[3-(4-ethynylpiperazin-1-yl)propoxy]-6-methoxyquinazolin-4-yl]amino]-2-pyridinyl]benzamide (PubChem CID 69308865) has the molecular formula C30H30ClN7O3 and a molecular weight of 572.07 g/mol. Its IUPAC name is 3-chloro-N-[5-[[7-[3-(4-ethynylpiperazin-1-yl)propoxy]-6-methoxyquinazolin-4-yl]amino]-2-pyridinyl]benzamide.
| Compound Name | 3-chloro-N-[5-[[7-[3-(4-ethynylpiperazin-1-yl)propoxy]-6-methoxyquinazolin-4-yl]amino]-2-pyridinyl]benzamide |
|---|---|
| PubChem CID | 69308865 |
| Molecular Formula | C30H30ClN7O3 |
| Molecular Weight | 572.07 g/mol |
| Exact Mass | 571.21 |
| IUPAC Name | 3-chloro-N-[5-[[7-[3-(4-ethynylpiperazin-1-yl)propoxy]-6-methoxyquinazolin-4-yl]amino]-2-pyridinyl]benzamide |
| SMILES | C#CN1CCN(CCCOc2cc3ncnc(Nc4ccc(NC(=O)c5cccc(Cl)c5)nc4)c3cc2OC)CC1 |
| InChI | InChI=1S/C30H30ClN7O3/c1-3-37-11-13-38(14-12-37)10-5-15-41-27-18-25-24(17-26(27)40-2)29(34-20-33-25)35-23-8-9-28(32-19-23)36-30(39)21-6-4-7-22(31)16-21/h1,4,6-9,16-20H,5,10-15H2,2H3,(H,32,36,39)(H,33,34,35) |
| InChIKey | NYECOMHWSMXJTQ-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 104.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.07 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|