C25H24N4O3 — CID 59295374
N-[4-[(6-methoxy-7-propoxyquinazolin-4-yl)amino]phenyl]benzamide (PubChem CID 59295374) has the molecular formula C25H24N4O3 and a molecular weight of 428.49 g/mol. Its IUPAC name is N-[4-[(6-methoxy-7-propoxyquinazolin-4-yl)amino]phenyl]benzamide.
| Compound Name | N-[4-[(6-methoxy-7-propoxyquinazolin-4-yl)amino]phenyl]benzamide |
|---|---|
| PubChem CID | 59295374 |
| Molecular Formula | C25H24N4O3 |
| Molecular Weight | 428.49 g/mol |
| Exact Mass | 428.18 |
| IUPAC Name | N-[4-[(6-methoxy-7-propoxyquinazolin-4-yl)amino]phenyl]benzamide |
| SMILES | CCCOc1cc2ncnc(Nc3ccc(NC(=O)c4ccccc4)cc3)c2cc1OC |
| InChI | InChI=1S/C25H24N4O3/c1-3-13-32-23-15-21-20(14-22(23)31-2)24(27-16-26-21)28-18-9-11-19(12-10-18)29-25(30)17-7-5-4-6-8-17/h4-12,14-16H,3,13H2,1-2H3,(H,29,30)(H,26,27,28) |
| InChIKey | BXZNOEKDDKORRA-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 85.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.49 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |