C23H19ClN4O3 — CID 18967578
2-chloro-4-[(6,7-dimethoxyquinazolin-4-yl)amino]-N-phenylbenzamide (PubChem CID 18967578) has the molecular formula C23H19ClN4O3 and a molecular weight of 434.88 g/mol. Its IUPAC name is 2-chloro-4-[(6,7-dimethoxyquinazolin-4-yl)amino]-N-phenylbenzamide.
| Compound Name | 2-chloro-4-[(6,7-dimethoxyquinazolin-4-yl)amino]-N-phenylbenzamide |
|---|---|
| PubChem CID | 18967578 |
| Molecular Formula | C23H19ClN4O3 |
| Molecular Weight | 434.88 g/mol |
| Exact Mass | 434.11 |
| IUPAC Name | 2-chloro-4-[(6,7-dimethoxyquinazolin-4-yl)amino]-N-phenylbenzamide |
| SMILES | COc1cc2ncnc(Nc3ccc(C(=O)Nc4ccccc4)c(Cl)c3)c2cc1OC |
| InChI | InChI=1S/C23H19ClN4O3/c1-30-20-11-17-19(12-21(20)31-2)25-13-26-22(17)27-15-8-9-16(18(24)10-15)23(29)28-14-6-4-3-5-7-14/h3-13H,1-2H3,(H,28,29)(H,25,26,27) |
| InChIKey | WZDNCDACXMXYJZ-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 85.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.88 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |