C19H20N4O4 — CID 54587267
ethyl N-[4-[(6,7-dimethoxyquinazolin-4-yl)amino]phenyl]carbamate (PubChem CID 54587267) has the molecular formula C19H20N4O4 and a molecular weight of 368.39 g/mol. Its IUPAC name is ethyl N-[4-[(6,7-dimethoxyquinazolin-4-yl)amino]phenyl]carbamate.
| Compound Name | ethyl N-[4-[(6,7-dimethoxyquinazolin-4-yl)amino]phenyl]carbamate |
|---|---|
| PubChem CID | 54587267 |
| Molecular Formula | C19H20N4O4 |
| Molecular Weight | 368.39 g/mol |
| Exact Mass | 368.15 |
| IUPAC Name | ethyl N-[4-[(6,7-dimethoxyquinazolin-4-yl)amino]phenyl]carbamate |
| SMILES | CCOC(=O)Nc1ccc(Nc2ncnc3cc(OC)c(OC)cc23)cc1 |
| InChI | InChI=1S/C19H20N4O4/c1-4-27-19(24)23-13-7-5-12(6-8-13)22-18-14-9-16(25-2)17(26-3)10-15(14)20-11-21-18/h5-11H,4H2,1-3H3,(H,23,24)(H,20,21,22) |
| InChIKey | JVWYBRODEHTVBN-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 94.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.39 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |