C22H26N4O4 — CID 11441241
2-amino-6-[4-[(6,7-dimethoxyquinazolin-4-yl)amino]phenyl]hexanoic acid (PubChem CID 11441241) has the molecular formula C22H26N4O4 and a molecular weight of 410.47 g/mol. Its IUPAC name is 2-amino-6-[4-[(6,7-dimethoxyquinazolin-4-yl)amino]phenyl]hexanoic acid.
| Compound Name | 2-amino-6-[4-[(6,7-dimethoxyquinazolin-4-yl)amino]phenyl]hexanoic acid |
|---|---|
| PubChem CID | 11441241 |
| Molecular Formula | C22H26N4O4 |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.20 |
| IUPAC Name | 2-amino-6-[4-[(6,7-dimethoxyquinazolin-4-yl)amino]phenyl]hexanoic acid |
| SMILES | COc1cc2ncnc(Nc3ccc(CCCCC(N)C(=O)O)cc3)c2cc1OC |
| InChI | InChI=1S/C22H26N4O4/c1-29-19-11-16-18(12-20(19)30-2)24-13-25-21(16)26-15-9-7-14(8-10-15)5-3-4-6-17(23)22(27)28/h7-13,17H,3-6,23H2,1-2H3,(H,27,28)(H,24,25,26) |
| InChIKey | LSTSYEDDNSXGCZ-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 119.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|