C27H35N5O4 — CID 59770632
N-[6-[[2-[4-[(6,7-dimethoxyquinazolin-4-yl)amino]phenyl]acetyl]amino]hexyl]propanamide (PubChem CID 59770632) has the molecular formula C27H35N5O4 and a molecular weight of 493.61 g/mol. Its IUPAC name is N-[6-[[2-[4-[(6,7-dimethoxyquinazolin-4-yl)amino]phenyl]acetyl]amino]hexyl]propanamide.
| Compound Name | N-[6-[[2-[4-[(6,7-dimethoxyquinazolin-4-yl)amino]phenyl]acetyl]amino]hexyl]propanamide |
|---|---|
| PubChem CID | 59770632 |
| Molecular Formula | C27H35N5O4 |
| Molecular Weight | 493.61 g/mol |
| Exact Mass | 493.27 |
| IUPAC Name | N-[6-[[2-[4-[(6,7-dimethoxyquinazolin-4-yl)amino]phenyl]acetyl]amino]hexyl]propanamide |
| SMILES | CCC(=O)NCCCCCCNC(=O)Cc1ccc(Nc2ncnc3cc(OC)c(OC)cc23)cc1 |
| InChI | InChI=1S/C27H35N5O4/c1-4-25(33)28-13-7-5-6-8-14-29-26(34)15-19-9-11-20(12-10-19)32-27-21-16-23(35-2)24(36-3)17-22(21)30-18-31-27/h9-12,16-18H,4-8,13-15H2,1-3H3,(H,28,33)(H,29,34)(H,30,31,32) |
| InChIKey | XIMGIXUPFPDGLY-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 114.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.61 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|