C23H25ClN4O5 — CID 175403103
2-acetamido-3-[4-[[6-(3-chloropropoxy)-7-methoxyquinazolin-4-yl]amino]phenyl]propanoic acid (PubChem CID 175403103) has the molecular formula C23H25ClN4O5 and a molecular weight of 472.93 g/mol. Its IUPAC name is 2-acetamido-3-[4-[[6-(3-chloropropoxy)-7-methoxyquinazolin-4-yl]amino]phenyl]propanoic acid.
| Compound Name | 2-acetamido-3-[4-[[6-(3-chloropropoxy)-7-methoxyquinazolin-4-yl]amino]phenyl]propanoic acid |
|---|---|
| PubChem CID | 175403103 |
| Molecular Formula | C23H25ClN4O5 |
| Molecular Weight | 472.93 g/mol |
| Exact Mass | 472.15 |
| IUPAC Name | 2-acetamido-3-[4-[[6-(3-chloropropoxy)-7-methoxyquinazolin-4-yl]amino]phenyl]propanoic acid |
| SMILES | COc1cc2ncnc(Nc3ccc(CC(NC(C)=O)C(=O)O)cc3)c2cc1OCCCCl |
| InChI | InChI=1S/C23H25ClN4O5/c1-14(29)27-19(23(30)31)10-15-4-6-16(7-5-15)28-22-17-11-21(33-9-3-8-24)20(32-2)12-18(17)25-13-26-22/h4-7,11-13,19H,3,8-10H2,1-2H3,(H,27,29)(H,30,31)(H,25,26,28) |
| InChIKey | UZQILGZKHQZISB-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 122.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.93 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|