C28H37N5O5 — CID 162518025
methyl 3-acetamido-3-[4-[[6-[3-(diethylamino)propoxy]-7-methoxyquinazolin-4-yl]amino]phenyl]propanoate (PubChem CID 162518025) has the molecular formula C28H37N5O5 and a molecular weight of 523.63 g/mol. Its IUPAC name is methyl 3-acetamido-3-[4-[[6-[3-(diethylamino)propoxy]-7-methoxyquinazolin-4-yl]amino]phenyl]propanoate.
| Compound Name | methyl 3-acetamido-3-[4-[[6-[3-(diethylamino)propoxy]-7-methoxyquinazolin-4-yl]amino]phenyl]propanoate |
|---|---|
| PubChem CID | 162518025 |
| Molecular Formula | C28H37N5O5 |
| Molecular Weight | 523.63 g/mol |
| Exact Mass | 523.28 |
| IUPAC Name | methyl 3-acetamido-3-[4-[[6-[3-(diethylamino)propoxy]-7-methoxyquinazolin-4-yl]amino]phenyl]propanoate |
| SMILES | CCN(CC)CCCOc1cc2c(Nc3ccc(C(CC(=O)OC)NC(C)=O)cc3)ncnc2cc1OC |
| InChI | InChI=1S/C28H37N5O5/c1-6-33(7-2)13-8-14-38-26-15-22-24(16-25(26)36-4)29-18-30-28(22)32-21-11-9-20(10-12-21)23(31-19(3)34)17-27(35)37-5/h9-12,15-16,18,23H,6-8,13-14,17H2,1-5H3,(H,31,34)(H,29,30,32) |
| InChIKey | SGZNMSHQAHWXJH-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 114.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.63 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|