C26H28N4O2 — CID 122628612
6,7-dimethoxy-N-[4-[(R)-phenyl(propylamino)methyl]phenyl]quinazolin-4-amine (PubChem CID 122628612) has the molecular formula C26H28N4O2 and a molecular weight of 428.54 g/mol. Its IUPAC name is 6,7-dimethoxy-N-[4-[(R)-phenyl(propylamino)methyl]phenyl]quinazolin-4-amine.
| Compound Name | 6,7-dimethoxy-N-[4-[(R)-phenyl(propylamino)methyl]phenyl]quinazolin-4-amine |
|---|---|
| PubChem CID | 122628612 |
| Molecular Formula | C26H28N4O2 |
| Molecular Weight | 428.54 g/mol |
| Exact Mass | 428.22 |
| IUPAC Name | 6,7-dimethoxy-N-[4-[(R)-phenyl(propylamino)methyl]phenyl]quinazolin-4-amine |
| SMILES | CCCN[C@H](c1ccccc1)c1ccc(Nc2ncnc3cc(OC)c(OC)cc23)cc1 |
| InChI | InChI=1S/C26H28N4O2/c1-4-14-27-25(18-8-6-5-7-9-18)19-10-12-20(13-11-19)30-26-21-15-23(31-2)24(32-3)16-22(21)28-17-29-26/h5-13,15-17,25,27H,4,14H2,1-3H3,(H,28,29,30)/t25-/m1/s1 |
| InChIKey | ZMBSJUJLTIVSAJ-RUZDIDTESA-N |
| XLogP | 5.48 |
| TPSA | 68.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.54 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |