C23H22N4 — CID 159200740
N-[4-[(S)-amino(phenyl)methyl]phenyl]-6,7-dimethylquinazolin-4-amine (PubChem CID 159200740) has the molecular formula C23H22N4 and a molecular weight of 354.46 g/mol. Its IUPAC name is N-[4-[(S)-amino(phenyl)methyl]phenyl]-6,7-dimethylquinazolin-4-amine.
| Compound Name | N-[4-[(S)-amino(phenyl)methyl]phenyl]-6,7-dimethylquinazolin-4-amine |
|---|---|
| PubChem CID | 159200740 |
| Molecular Formula | C23H22N4 |
| Molecular Weight | 354.46 g/mol |
| Exact Mass | 354.18 |
| IUPAC Name | N-[4-[(S)-amino(phenyl)methyl]phenyl]-6,7-dimethylquinazolin-4-amine |
| SMILES | Cc1cc2ncnc(Nc3ccc([C@@H](N)c4ccccc4)cc3)c2cc1C |
| InChI | InChI=1S/C23H22N4/c1-15-12-20-21(13-16(15)2)25-14-26-23(20)27-19-10-8-18(9-11-19)22(24)17-6-4-3-5-7-17/h3-14,22H,24H2,1-2H3,(H,25,26,27)/t22-/m0/s1 |
| InChIKey | CICYWYAXMZEMRZ-QFIPXVFZSA-N |
| XLogP | 5.04 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.46 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |