C18H16N4 — CID 142010031
N-(1H-indol-5-yl)-6,7-dimethylquinazolin-4-amine (PubChem CID 142010031) has the molecular formula C18H16N4 and a molecular weight of 288.35 g/mol. Its IUPAC name is N-(1H-indol-5-yl)-6,7-dimethylquinazolin-4-amine.
| Compound Name | N-(1H-indol-5-yl)-6,7-dimethylquinazolin-4-amine |
|---|---|
| PubChem CID | 142010031 |
| Molecular Formula | C18H16N4 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.14 |
| IUPAC Name | N-(1H-indol-5-yl)-6,7-dimethylquinazolin-4-amine |
| SMILES | Cc1cc2ncnc(Nc3ccc4[nH]ccc4c3)c2cc1C |
| InChI | InChI=1S/C18H16N4/c1-11-7-15-17(8-12(11)2)20-10-21-18(15)22-14-3-4-16-13(9-14)5-6-19-16/h3-10,19H,1-2H3,(H,20,21,22) |
| InChIKey | SIIGDOYUDWDTQA-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |