C18H17N5 — CID 23366722
4-N-(1H-indol-5-yl)-6-N,6-N-dimethylquinazoline-4,6-diamine (PubChem CID 23366722) has the molecular formula C18H17N5 and a molecular weight of 303.37 g/mol. Its IUPAC name is 4-N-(1H-indol-5-yl)-6-N,6-N-dimethylquinazoline-4,6-diamine.
| Compound Name | 4-N-(1H-indol-5-yl)-6-N,6-N-dimethylquinazoline-4,6-diamine |
|---|---|
| PubChem CID | 23366722 |
| Molecular Formula | C18H17N5 |
| Molecular Weight | 303.37 g/mol |
| Exact Mass | 303.15 |
| IUPAC Name | 4-N-(1H-indol-5-yl)-6-N,6-N-dimethylquinazoline-4,6-diamine |
| SMILES | CN(C)c1ccc2ncnc(Nc3ccc4[nH]ccc4c3)c2c1 |
| InChI | InChI=1S/C18H17N5/c1-23(2)14-4-6-17-15(10-14)18(21-11-20-17)22-13-3-5-16-12(9-13)7-8-19-16/h3-11,19H,1-2H3,(H,20,21,22) |
| InChIKey | ZLXRYKVUERFRBW-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.37 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |