C10H12N2 — CID 23274
N,N-dimethyl-1H-indol-5-amine (PubChem CID 23274) has the molecular formula C10H12N2 and a molecular weight of 160.22 g/mol. Its IUPAC name is N,N-dimethyl-1H-indol-5-amine.
| Compound Name | N,N-dimethyl-1H-indol-5-amine |
|---|---|
| PubChem CID | 23274 |
| Molecular Formula | C10H12N2 |
| Molecular Weight | 160.22 g/mol |
| Exact Mass | 160.10 |
| IUPAC Name | N,N-dimethyl-1H-indol-5-amine |
| SMILES | CN(C)c1ccc2[nH]ccc2c1 |
| InChI | InChI=1S/C10H12N2/c1-12(2)9-3-4-10-8(7-9)5-6-11-10/h3-7,11H,1-2H3 |
| InChIKey | GDUMASAEKWMYGV-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 19.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.22 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |