C15H25N3 — CID 142890112
N,N-diethylethanamine;N-methyl-1H-indol-5-amine (PubChem CID 142890112) has the molecular formula C15H25N3 and a molecular weight of 247.39 g/mol. Its IUPAC name is N,N-diethylethanamine;N-methyl-1H-indol-5-amine.
| Compound Name | N,N-diethylethanamine;N-methyl-1H-indol-5-amine |
|---|---|
| PubChem CID | 142890112 |
| Molecular Formula | C15H25N3 |
| Molecular Weight | 247.39 g/mol |
| Exact Mass | 247.20 |
| IUPAC Name | N,N-diethylethanamine;N-methyl-1H-indol-5-amine |
| SMILES | CCN(CC)CC.CNc1ccc2[nH]ccc2c1 |
| InChI | InChI=1S/C9H10N2.C6H15N/c1-10-8-2-3-9-7(6-8)4-5-11-9;1-4-7(5-2)6-3/h2-6,10-11H,1H3;4-6H2,1-3H3 |
| InChIKey | QWPPPLBVTINNGM-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 31.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.39 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |