C25H32N4O — CID 166234381
1,3-bis[ethyl(1H-indol-5-ylmethyl)amino]propan-2-ol (PubChem CID 166234381) has the molecular formula C25H32N4O and a molecular weight of 404.56 g/mol. Its IUPAC name is 1,3-bis[ethyl(1H-indol-5-ylmethyl)amino]propan-2-ol.
| Compound Name | 1,3-bis[ethyl(1H-indol-5-ylmethyl)amino]propan-2-ol |
|---|---|
| PubChem CID | 166234381 |
| Molecular Formula | C25H32N4O |
| Molecular Weight | 404.56 g/mol |
| Exact Mass | 404.26 |
| IUPAC Name | 1,3-bis[ethyl(1H-indol-5-ylmethyl)amino]propan-2-ol |
| SMILES | CCN(Cc1ccc2[nH]ccc2c1)CC(O)CN(CC)Cc1ccc2[nH]ccc2c1 |
| InChI | InChI=1S/C25H32N4O/c1-3-28(15-19-5-7-24-21(13-19)9-11-26-24)17-23(30)18-29(4-2)16-20-6-8-25-22(14-20)10-12-27-25/h5-14,23,26-27,30H,3-4,15-18H2,1-2H3 |
| InChIKey | PFLWDWAYAZMWOQ-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 58.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.56 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |