C13H19N3 — CID 103102150
N'-ethyl-N'-(1H-indol-6-ylmethyl)ethane-1,2-diamine (PubChem CID 103102150) has the molecular formula C13H19N3 and a molecular weight of 217.32 g/mol. Its IUPAC name is N'-ethyl-N'-(1H-indol-6-ylmethyl)ethane-1,2-diamine.
| Compound Name | N'-ethyl-N'-(1H-indol-6-ylmethyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 103102150 |
| Molecular Formula | C13H19N3 |
| Molecular Weight | 217.32 g/mol |
| Exact Mass | 217.16 |
| IUPAC Name | N'-ethyl-N'-(1H-indol-6-ylmethyl)ethane-1,2-diamine |
| SMILES | CCN(CCN)Cc1ccc2cc[nH]c2c1 |
| InChI | InChI=1S/C13H19N3/c1-2-16(8-6-14)10-11-3-4-12-5-7-15-13(12)9-11/h3-5,7,9,15H,2,6,8,10,14H2,1H3 |
| InChIKey | SEMNJVCQEVAURR-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 45.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.32 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |