C9H16N2S — CID 103102209
N'-ethyl-N'-(thiophen-3-ylmethyl)ethane-1,2-diamine (PubChem CID 103102209) has the molecular formula C9H16N2S and a molecular weight of 184.31 g/mol. Its IUPAC name is N'-ethyl-N'-(thiophen-3-ylmethyl)ethane-1,2-diamine.
| Compound Name | N'-ethyl-N'-(thiophen-3-ylmethyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 103102209 |
| Molecular Formula | C9H16N2S |
| Molecular Weight | 184.31 g/mol |
| Exact Mass | 184.10 |
| IUPAC Name | N'-ethyl-N'-(thiophen-3-ylmethyl)ethane-1,2-diamine |
| SMILES | CCN(CCN)Cc1ccsc1 |
| InChI | InChI=1S/C9H16N2S/c1-2-11(5-4-10)7-9-3-6-12-8-9/h3,6,8H,2,4-5,7,10H2,1H3 |
| InChIKey | POIYPDITVUASPP-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.31 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |