C9H13NO2S — CID 55028747
2-[ethyl(thiophen-3-ylmethyl)amino]acetic acid (PubChem CID 55028747) has the molecular formula C9H13NO2S and a molecular weight of 199.28 g/mol. Its IUPAC name is 2-[ethyl(thiophen-3-ylmethyl)amino]acetic acid.
| Compound Name | 2-[ethyl(thiophen-3-ylmethyl)amino]acetic acid |
|---|---|
| PubChem CID | 55028747 |
| Molecular Formula | C9H13NO2S |
| Molecular Weight | 199.28 g/mol |
| Exact Mass | 199.07 |
| IUPAC Name | 2-[ethyl(thiophen-3-ylmethyl)amino]acetic acid |
| SMILES | CCN(CC(=O)O)Cc1ccsc1 |
| InChI | InChI=1S/C9H13NO2S/c1-2-10(6-9(11)12)5-8-3-4-13-7-8/h3-4,7H,2,5-6H2,1H3,(H,11,12) |
| InChIKey | WCZMCPOQJAWAJS-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.28 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |