C10H15NOS — CID 60635955
N,N-diethyl-2-thiophen-3-ylacetamide (PubChem CID 60635955) has the molecular formula C10H15NOS and a molecular weight of 197.30 g/mol. Its IUPAC name is N,N-diethyl-2-thiophen-3-ylacetamide.
| Compound Name | N,N-diethyl-2-thiophen-3-ylacetamide |
|---|---|
| PubChem CID | 60635955 |
| Molecular Formula | C10H15NOS |
| Molecular Weight | 197.30 g/mol |
| Exact Mass | 197.09 |
| IUPAC Name | N,N-diethyl-2-thiophen-3-ylacetamide |
| SMILES | CCN(CC)C(=O)Cc1ccsc1 |
| InChI | InChI=1S/C10H15NOS/c1-3-11(4-2)10(12)7-9-5-6-13-8-9/h5-6,8H,3-4,7H2,1-2H3 |
| InChIKey | IYRDJLSXFOZDKG-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.30 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |