C13H22N2OS — CID 113411312
N,N-diethyl-3-(2-thiophen-3-ylethylamino)propanamide (PubChem CID 113411312) has the molecular formula C13H22N2OS and a molecular weight of 254.40 g/mol. Its IUPAC name is N,N-diethyl-3-(2-thiophen-3-ylethylamino)propanamide.
| Compound Name | N,N-diethyl-3-(2-thiophen-3-ylethylamino)propanamide |
|---|---|
| PubChem CID | 113411312 |
| Molecular Formula | C13H22N2OS |
| Molecular Weight | 254.40 g/mol |
| Exact Mass | 254.15 |
| IUPAC Name | N,N-diethyl-3-(2-thiophen-3-ylethylamino)propanamide |
| SMILES | CCN(CC)C(=O)CCNCCc1ccsc1 |
| InChI | InChI=1S/C13H22N2OS/c1-3-15(4-2)13(16)6-9-14-8-5-12-7-10-17-11-12/h7,10-11,14H,3-6,8-9H2,1-2H3 |
| InChIKey | HTOPWYSYIQRFED-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.40 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|