C12H18ClNOS — CID 107205870
N-(5-chloropentyl)-N-methyl-2-thiophen-3-ylacetamide (PubChem CID 107205870) has the molecular formula C12H18ClNOS and a molecular weight of 259.80 g/mol. Its IUPAC name is N-(5-chloropentyl)-N-methyl-2-thiophen-3-ylacetamide.
| Compound Name | N-(5-chloropentyl)-N-methyl-2-thiophen-3-ylacetamide |
|---|---|
| PubChem CID | 107205870 |
| Molecular Formula | C12H18ClNOS |
| Molecular Weight | 259.80 g/mol |
| Exact Mass | 259.08 |
| IUPAC Name | N-(5-chloropentyl)-N-methyl-2-thiophen-3-ylacetamide |
| SMILES | CN(CCCCCCl)C(=O)Cc1ccsc1 |
| InChI | InChI=1S/C12H18ClNOS/c1-14(7-4-2-3-6-13)12(15)9-11-5-8-16-10-11/h5,8,10H,2-4,6-7,9H2,1H3 |
| InChIKey | FEZXKQVEJLMXHU-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.80 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|