C11H16BrNOS — CID 80660414
N-(2-bromoethyl)-N-propyl-2-thiophen-3-ylacetamide (PubChem CID 80660414) has the molecular formula C11H16BrNOS and a molecular weight of 290.23 g/mol. Its IUPAC name is N-(2-bromoethyl)-N-propyl-2-thiophen-3-ylacetamide.
| Compound Name | N-(2-bromoethyl)-N-propyl-2-thiophen-3-ylacetamide |
|---|---|
| PubChem CID | 80660414 |
| Molecular Formula | C11H16BrNOS |
| Molecular Weight | 290.23 g/mol |
| Exact Mass | 289.01 |
| IUPAC Name | N-(2-bromoethyl)-N-propyl-2-thiophen-3-ylacetamide |
| SMILES | CCCN(CCBr)C(=O)Cc1ccsc1 |
| InChI | InChI=1S/C11H16BrNOS/c1-2-5-13(6-4-12)11(14)8-10-3-7-15-9-10/h3,7,9H,2,4-6,8H2,1H3 |
| InChIKey | LQNGFNHESHNJOJ-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.23 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|